benzene-1,4-dicarboxylic acid


1,4-benzenedicarboxylic acid; benzene-1,4-dicarboxylic acid; p-phthalic acid; terephthalic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Terephtalsäure); p. 13, 15, 29, 31, 77, 251, 280, 979,
MeSH:Antioxidants
CAS RN:[100-21-0]
Formula:C8H6O4; 166.13 g/mol
InChiKey:KKEYFWRCBNTPAC-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(cc1)C(O)=O
Molecular structure of benzene-1,4-dicarboxylic acid
Density:1.522 g/mL
Molar volume:109.2 mL/mol
Dipole moment:2.60 D
Melting point:300 °C
Log10 partition octanol / water:2.00

Isomers

benzene-1,3-dicarboxylic acid
Molecular structure of benzene-1,3-dicarboxylic acid
benzene-1,4-dicarboxylic acid
Molecular structure of benzene-1,4-dicarboxylic acid
2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
Molecular structure of 2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
Molecular structure of exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
3-formyl-2-hydroxybenzoic acid
Molecular structure of 3-formyl-2-hydroxybenzoic acid
3-formyl-4-hydroxybenzoic acid
Molecular structure of 3-formyl-4-hydroxybenzoic acid
4-formyl-3-hydroxybenzoic acid
Molecular structure of 4-formyl-3-hydroxybenzoic acid
5-formylsalicylic acid
Molecular structure of 5-formylsalicylic acid
3,4-(methylenedioxy)benzoic acid
Molecular structure of 3,4-(methylenedioxy)benzoic acid
phthalic acid
Molecular structure of phthalic acid